cartkatrickpu cartkatrickpu

03-02-2017
Mathematics

contestada

What is the solution to this equation?

3x – 5 + 2x = 25

A. x = 4
B. x = 6
C. x = 30
D. x = 20

Respuesta :

apologiabiology apologiabiology

03-02-2017

add like terms
5x-5=25
5(x-1)=25
divide both sides by 5
x-1=5
addd 1
x=6

B

Answer Link

durtyjoe durtyjoe

03-02-2017

b x =6 plug in and order of operations

Answer Link

Otras preguntas

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Please help! What is the answer?

were can the height of an obtuse, acute, and right triangle be found? inside outside or on

A line has slope 3 and y–intercept 4. Which answer is the equation of the line? A. y = 3x + 4 B. y=3/4x−4 C. y=3x−4 D. y = 4x + 3

what is the name of the following compound? a. phenylhyde b. cyclohexylhyde c. benzaldehyde d. phenol aldehyde

A study involving _____ cultures found that there is variability of personalities between cultures. A. 15 B. 31 C. 51 D. 101

Which of the following stanzas use imagery to convey a mood of dread? Now droops the milk-white peacock like a ghost, And like a ghost she glimmers on to me. N

Evaluate 6 C 3 . 18 20 60 120

In 1881, Booker T. Washington founded the Tuskegee Institute in order to

why is a memoir an appropriate text structure for rosa parks to use to share her personal experience of a historical event